C13H17NO2 — CID 115075402
7-(oxolan-3-yloxy)-1,2,3,4-tetrahydroquinoline (PubChem CID 115075402) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 7-(oxolan-3-yloxy)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(oxolan-3-yloxy)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 115075402 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 7-(oxolan-3-yloxy)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(cc1OC1CCOC1)NCCC2 |
| InChI | InChI=1S/C13H17NO2/c1-2-10-3-4-11(8-13(10)14-6-1)16-12-5-7-15-9-12/h3-4,8,12,14H,1-2,5-7,9H2 |
| InChIKey | FULNYFSWLGEFLX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |