About 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole
6-(thietan-3-yloxy)-2,3-dihydro-1H-indole (PubChem CID 115074762) has the molecular formula C11H13NOS
and a molecular weight of 207.30 g/mol. Its IUPAC name is 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole |
| PubChem CID | 115074762 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1OC1CSC1)NCC2 |
| InChI | InChI=1S/C11H13NOS/c1-2-9(13-10-6-14-7-10)5-11-8(1)3-4-12-11/h1-2,5,10,12H,3-4,6-7H2 |
| InChIKey | YDQRAZKDZYWULV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole?
The IUPAC name of 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole (CID 115074762) is 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole.
What is the SMILES notation for 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole?
The canonical SMILES for 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole is c1cc2c(cc1OC1CSC1)NCC2.
What is the InChIKey of 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole?
The InChIKey is YDQRAZKDZYWULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS/c1-2-9(13-10-6-14-7-10)5-11-8(1)3-4-12-11/h1-2,5,10,12H,3-4,6-7H2.
What are the key properties of 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole?
6-(thietan-3-yloxy)-2,3-dihydro-1H-indole has a molecular weight of 207.30 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(thietan-3-yloxy)-2,3-dihydro-1H-indole is sourced from PubChem (CID 115074762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).