C14H19NOS — CID 115074777
6-[(3-methylthiolan-3-yl)methoxy]-2,3-dihydro-1H-indole (PubChem CID 115074777) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 6-[(3-methylthiolan-3-yl)methoxy]-2,3-dihydro-1H-indole.
| Compound Name | 6-[(3-methylthiolan-3-yl)methoxy]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115074777 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 6-[(3-methylthiolan-3-yl)methoxy]-2,3-dihydro-1H-indole |
| SMILES | CC1(COc2ccc3c(c2)NCC3)CCSC1 |
| InChI | InChI=1S/C14H19NOS/c1-14(5-7-17-10-14)9-16-12-3-2-11-4-6-15-13(11)8-12/h2-3,8,15H,4-7,9-10H2,1H3 |
| InChIKey | LFPDDOYFICEKKW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |