C10H11F2NO — CID 16792853
6-(difluoromethoxy)-1,2,3,4-tetrahydroquinoline (PubChem CID 16792853) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 6-(difluoromethoxy)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(difluoromethoxy)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 16792853 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 6-(difluoromethoxy)-1,2,3,4-tetrahydroquinoline |
| SMILES | FC(F)Oc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C10H11F2NO/c11-10(12)14-8-3-4-9-7(6-8)2-1-5-13-9/h3-4,6,10,13H,1-2,5H2 |
| InChIKey | DZDFJYGJGKTWJD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|