C14H25N — CID 144598135
ethane;6-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 144598135) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is ethane;6-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | ethane;6-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 144598135 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | ethane;6-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC.CC.Cc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C10H13N.2C2H6/c1-8-4-5-10-9(7-8)3-2-6-11-10;2*1-2/h4-5,7,11H,2-3,6H2,1H3;2*1-2H3 |
| InChIKey | FODBMJXRIHVKQW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |