C10H16NOP — CID 143733267
methylphosphane;1,2,3,4-tetrahydroquinolin-6-ol (PubChem CID 143733267) has the molecular formula C10H16NOP and a molecular weight of 197.22 g/mol. Its IUPAC name is methylphosphane;1,2,3,4-tetrahydroquinolin-6-ol.
| Compound Name | methylphosphane;1,2,3,4-tetrahydroquinolin-6-ol |
|---|---|
| PubChem CID | 143733267 |
| Molecular Formula | C10H16NOP |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | methylphosphane;1,2,3,4-tetrahydroquinolin-6-ol |
| SMILES | CP.Oc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C9H11NO.CH5P/c11-8-3-4-9-7(6-8)2-1-5-10-9;1-2/h3-4,6,10-11H,1-2,5H2;2H2,1H3 |
| InChIKey | NMNRJTSKXRLYLY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|