C9H12BNO2 — CID 69113319
1,2,3,4-tetrahydroquinolin-6-ylboronic acid (PubChem CID 69113319) has the molecular formula C9H12BNO2 and a molecular weight of 177.01 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinolin-6-ylboronic acid.
| Compound Name | 1,2,3,4-tetrahydroquinolin-6-ylboronic acid |
|---|---|
| PubChem CID | 69113319 |
| Molecular Formula | C9H12BNO2 |
| Molecular Weight | 177.01 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1,2,3,4-tetrahydroquinolin-6-ylboronic acid |
| SMILES | OB(O)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C9H12BNO2/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9/h3-4,6,11-13H,1-2,5H2 |
| InChIKey | NNOYRLPTLGLLOB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.01 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|