C15H22N2 — CID 39247840
6-(azepan-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 39247840) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 6-(azepan-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(azepan-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 39247840 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 6-(azepan-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(cc1N1CCCCCC1)CCCN2 |
| InChI | InChI=1S/C15H22N2/c1-2-4-11-17(10-3-1)14-7-8-15-13(12-14)6-5-9-16-15/h7-8,12,16H,1-6,9-11H2 |
| InChIKey | WGLZWFUFLRFLJQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|