C15H22N2 — CID 28776156
6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 28776156) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 28776156 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 6-(piperidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(cc1CN1CCCCC1)CCCN2 |
| InChI | InChI=1S/C15H22N2/c1-2-9-17(10-3-1)12-13-6-7-15-14(11-13)5-4-8-16-15/h6-7,11,16H,1-5,8-10,12H2 |
| InChIKey | AXJUTTHVGMGACZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |