C14H21N3 — CID 82263603
7-(piperazin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 82263603) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 7-(piperazin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(piperazin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 82263603 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 7-(piperazin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(cc1CN1CCNCC1)NCCC2 |
| InChI | InChI=1S/C14H21N3/c1-2-13-4-3-12(10-14(13)16-5-1)11-17-8-6-15-7-9-17/h3-4,10,15-16H,1-2,5-9,11H2 |
| InChIKey | YNKPAOYDRCCQIB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |