C11H11N — CID 19702071
6-ethynyl-1,2,3,4-tetrahydroquinoline (PubChem CID 19702071) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is 6-ethynyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-ethynyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 19702071 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 6-ethynyl-1,2,3,4-tetrahydroquinoline |
| SMILES | C#Cc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C11H11N/c1-2-9-5-6-11-10(8-9)4-3-7-12-11/h1,5-6,8,12H,3-4,7H2 |
| InChIKey | NGCUYQBQSOUOFO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|