C11H11NO — CID 169485135
3-(2,3-dihydro-1H-indol-5-yl)prop-2-yn-1-ol (PubChem CID 169485135) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-5-yl)prop-2-yn-1-ol.
| Compound Name | 3-(2,3-dihydro-1H-indol-5-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 169485135 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-5-yl)prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C11H11NO/c13-7-1-2-9-3-4-11-10(8-9)5-6-12-11/h3-4,8,12-13H,5-7H2 |
| InChIKey | JZFZLMGOWTYXTE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|