C11H13N — CID 130132973
5-prop-1-en-2-yl-2,3-dihydro-1H-indole (PubChem CID 130132973) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 5-prop-1-en-2-yl-2,3-dihydro-1H-indole.
| Compound Name | 5-prop-1-en-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 130132973 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 5-prop-1-en-2-yl-2,3-dihydro-1H-indole |
| SMILES | C=C(C)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C11H13N/c1-8(2)9-3-4-11-10(7-9)5-6-12-11/h3-4,7,12H,1,5-6H2,2H3 |
| InChIKey | YVYUGFWIUUEUCP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |