C10H11Cl2NO — CID 56766314
2-chloro-1-(2,3-dihydro-1H-indol-5-yl)ethanone;hydrochloride (PubChem CID 56766314) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is 2-chloro-1-(2,3-dihydro-1H-indol-5-yl)ethanone;hydrochloride.
| Compound Name | 2-chloro-1-(2,3-dihydro-1H-indol-5-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 56766314 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2-chloro-1-(2,3-dihydro-1H-indol-5-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(CCl)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C10H10ClNO.ClH/c11-6-10(13)8-1-2-9-7(5-8)3-4-12-9;/h1-2,5,12H,3-4,6H2;1H |
| InChIKey | LHJKKAOLHRKXDC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|