C15H21NO — CID 116554160
1-(2,3-dihydro-1H-indol-5-yl)-3-methylhexan-1-one (PubChem CID 116554160) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-5-yl)-3-methylhexan-1-one.
| Compound Name | 1-(2,3-dihydro-1H-indol-5-yl)-3-methylhexan-1-one |
|---|---|
| PubChem CID | 116554160 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-5-yl)-3-methylhexan-1-one |
| SMILES | CCCC(C)CC(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C15H21NO/c1-3-4-11(2)9-15(17)13-5-6-14-12(10-13)7-8-16-14/h5-6,10-11,16H,3-4,7-9H2,1-2H3 |
| InChIKey | UMRCHSIOWPNFKG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |