C20H22N2O2 — CID 170999934
1-(2,3-dihydro-1H-indol-5-yl)ethanone (PubChem CID 170999934) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-5-yl)ethanone.
| Compound Name | 1-(2,3-dihydro-1H-indol-5-yl)ethanone |
|---|---|
| PubChem CID | 170999934 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-5-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)CCN2.CC(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/2C10H11NO/c2*1-7(12)8-2-3-10-9(6-8)4-5-11-10/h2*2-3,6,11H,4-5H2,1H3 |
| InChIKey | HAGQMOKQYDZPJN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |