C11H14N2O2 — CID 64974739
N-ethoxy-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 64974739) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is N-ethoxy-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-ethoxy-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 64974739 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-ethoxy-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | CCONC(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C11H14N2O2/c1-2-15-13-11(14)9-3-4-10-8(7-9)5-6-12-10/h3-4,7,12H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | ZRGSUMIZJPWWLJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|