2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid

C11H12N2O4 — CID 113498230

IUPAC2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid
SMILESO=C(O)CONC(=O)c1ccc2c(c1)CCN2
InChIInChI=1S/C11H12N2O4/c14-10(15)6-17-13-11(16)8-1-2-9-7(5-8)3-4-12-9/h1-2,5,12H,3-4,6H2,(H,13,16)(H,14,15)
InChIKeyLLDXPAKXAFZJAH-UHFFFAOYSA-N
MW236.23 g/mol
LogP0.40
Rot. Bonds4

About 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid

2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid (PubChem CID 113498230) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid.

Molecular Properties

Compound Name2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid
PubChem CID113498230
Molecular FormulaC11H12N2O4
Molecular Weight236.23 g/mol
Exact Mass236.08
IUPAC Name2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid
SMILESO=C(O)CONC(=O)c1ccc2c(c1)CCN2
InChIInChI=1S/C11H12N2O4/c14-10(15)6-17-13-11(16)8-1-2-9-7(5-8)3-4-12-9/h1-2,5,12H,3-4,6H2,(H,13,16)(H,14,15)
InChIKeyLLDXPAKXAFZJAH-UHFFFAOYSA-N
XLogP0.40
TPSA87.66 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.23
LogP ≤ 50.40
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid?
The IUPAC name of 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid (CID 113498230) is 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid.
What is the SMILES notation for 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid?
The canonical SMILES for 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid is O=C(O)CONC(=O)c1ccc2c(c1)CCN2.
What is the InChIKey of 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid?
The InChIKey is LLDXPAKXAFZJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4/c14-10(15)6-17-13-11(16)8-1-2-9-7(5-8)3-4-12-9/h1-2,5,12H,3-4,6H2,(H,13,16)(H,14,15).
What are the key properties of 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid?
2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid has a molecular weight of 236.23 g/mol, XLogP of 0.40, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1H-indole-5-carbonylamino)oxyacetic acid is sourced from PubChem (CID 113498230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).