C13H16N2O3 — CID 60780386
methyl 2-(2,3-dihydro-1H-indole-5-carbonylamino)propanoate (PubChem CID 60780386) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1H-indole-5-carbonylamino)propanoate.
| Compound Name | methyl 2-(2,3-dihydro-1H-indole-5-carbonylamino)propanoate |
|---|---|
| PubChem CID | 60780386 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl 2-(2,3-dihydro-1H-indole-5-carbonylamino)propanoate |
| SMILES | COC(=O)C(C)NC(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C13H16N2O3/c1-8(13(17)18-2)15-12(16)10-3-4-11-9(7-10)5-6-14-11/h3-4,7-8,14H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | QGMRJCASXOTSCB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |