C15H16N2OS — CID 43534403
N-(1-thiophen-2-ylethyl)-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 43534403) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is N-(1-thiophen-2-ylethyl)-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-(1-thiophen-2-ylethyl)-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 43534403 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-(1-thiophen-2-ylethyl)-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)CCN2)c1cccs1 |
| InChI | InChI=1S/C15H16N2OS/c1-10(14-3-2-8-19-14)17-15(18)12-4-5-13-11(9-12)6-7-16-13/h2-5,8-10,16H,6-7H2,1H3,(H,17,18) |
| InChIKey | LYVWTFSAHWTCLJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |