C15H20N2O3 — CID 61174014
(2S)-2-(2,3-dihydro-1H-indole-5-carbonylamino)-3-methylpentanoic acid (PubChem CID 61174014) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1H-indole-5-carbonylamino)-3-methylpentanoic acid.
| Compound Name | (2S)-2-(2,3-dihydro-1H-indole-5-carbonylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 61174014 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1H-indole-5-carbonylamino)-3-methylpentanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)c1ccc2c(c1)CCN2)C(=O)O |
| InChI | InChI=1S/C15H20N2O3/c1-3-9(2)13(15(19)20)17-14(18)11-4-5-12-10(8-11)6-7-16-12/h4-5,8-9,13,16H,3,6-7H2,1-2H3,(H,17,18)(H,19,20)/t9?,13-/m0/s1 |
| InChIKey | NTUQGZQIYSGGLP-NCWAPJAISA-N |
| XLogP | 1.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |