C17H17FN2O — CID 81374595
N-[(1R)-1-(2-fluorophenyl)ethyl]-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 81374595) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is N-[(1R)-1-(2-fluorophenyl)ethyl]-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-[(1R)-1-(2-fluorophenyl)ethyl]-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 81374595 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-[(1R)-1-(2-fluorophenyl)ethyl]-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(c1)CCN2)c1ccccc1F |
| InChI | InChI=1S/C17H17FN2O/c1-11(14-4-2-3-5-15(14)18)20-17(21)13-6-7-16-12(10-13)8-9-19-16/h2-7,10-11,19H,8-9H2,1H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | YRIOLVKLHKSYSV-LLVKDONJSA-N |
| XLogP | 3.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |