C16H22N2O2 — CID 104938337
N-[1-(oxan-4-yl)ethyl]-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 104938337) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[1-(oxan-4-yl)ethyl]-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-[1-(oxan-4-yl)ethyl]-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 104938337 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[1-(oxan-4-yl)ethyl]-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)CCN2)C1CCOCC1 |
| InChI | InChI=1S/C16H22N2O2/c1-11(12-5-8-20-9-6-12)18-16(19)14-2-3-15-13(10-14)4-7-17-15/h2-3,10-12,17H,4-9H2,1H3,(H,18,19) |
| InChIKey | MSWVPDPXQHFPPJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |