C13H11N3O — CID 116554112
2,3-dihydro-1H-indol-5-yl(pyrimidin-5-yl)methanone (PubChem CID 116554112) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-5-yl(pyrimidin-5-yl)methanone.
| Compound Name | 2,3-dihydro-1H-indol-5-yl(pyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 116554112 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2,3-dihydro-1H-indol-5-yl(pyrimidin-5-yl)methanone |
| SMILES | O=C(c1cncnc1)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C13H11N3O/c17-13(11-6-14-8-15-7-11)10-1-2-12-9(5-10)3-4-16-12/h1-2,5-8,16H,3-4H2 |
| InChIKey | CJJSNRFUIUIDLK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |