C15H15NO2 — CID 115103984
4-(2,3-dihydro-1H-indol-5-ylmethoxy)phenol (PubChem CID 115103984) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-5-ylmethoxy)phenol.
| Compound Name | 4-(2,3-dihydro-1H-indol-5-ylmethoxy)phenol |
|---|---|
| PubChem CID | 115103984 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-5-ylmethoxy)phenol |
| SMILES | Oc1ccc(OCc2ccc3c(c2)CCN3)cc1 |
| InChI | InChI=1S/C15H15NO2/c17-13-2-4-14(5-3-13)18-10-11-1-6-15-12(9-11)7-8-16-15/h1-6,9,16-17H,7-8,10H2 |
| InChIKey | KRHFESUPHISOEK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |