C17H19NO — CID 115104157
7-[(4-methylphenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 115104157) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 7-[(4-methylphenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-[(4-methylphenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 115104157 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 7-[(4-methylphenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1ccc(OCc2ccc3c(c2)CNCC3)cc1 |
| InChI | InChI=1S/C17H19NO/c1-13-2-6-17(7-3-13)19-12-14-4-5-15-8-9-18-11-16(15)10-14/h2-7,10,18H,8-9,11-12H2,1H3 |
| InChIKey | LBEZXHZLANZXBK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |