C12H19NO — CID 143868283
ethane;7-methoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 143868283) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;7-methoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | ethane;7-methoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 143868283 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | ethane;7-methoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC.COc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C10H13NO.C2H6/c1-12-10-3-2-8-4-5-11-7-9(8)6-10;1-2/h2-3,6,11H,4-5,7H2,1H3;1-2H3 |
| InChIKey | WAGZVNGRKBHHRL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |