C22H38N2O2 — CID 142306577
N-(2-cyclohexylethyl)formamide;7-methoxy-1,2,3,4-tetrahydroisoquinoline;propane (PubChem CID 142306577) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)formamide;7-methoxy-1,2,3,4-tetrahydroisoquinoline;propane.
| Compound Name | N-(2-cyclohexylethyl)formamide;7-methoxy-1,2,3,4-tetrahydroisoquinoline;propane |
|---|---|
| PubChem CID | 142306577 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | N-(2-cyclohexylethyl)formamide;7-methoxy-1,2,3,4-tetrahydroisoquinoline;propane |
| SMILES | CCC.COc1ccc2c(c1)CNCC2.O=CNCCC1CCCCC1 |
| InChI | InChI=1S/C10H13NO.C9H17NO.C3H8/c1-12-10-3-2-8-4-5-11-7-9(8)6-10;11-8-10-7-6-9-4-2-1-3-5-9;1-3-2/h2-3,6,11H,4-5,7H2,1H3;8-9H,1-7H2,(H,10,11);3H2,1-2H3 |
| InChIKey | KYHINSNAQDCIRD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|