C10H13NO — CID 134564811
1,1-dideuterio-6-methoxy-3,4-dihydro-2H-isoquinoline (PubChem CID 134564811) has the molecular formula C10H13NO and a molecular weight of 165.23 g/mol. Its IUPAC name is 1,1-dideuterio-6-methoxy-3,4-dihydro-2H-isoquinoline.
| Compound Name | 1,1-dideuterio-6-methoxy-3,4-dihydro-2H-isoquinoline |
|---|---|
| PubChem CID | 134564811 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 165.23 g/mol |
| Exact Mass | 165.11 |
| IUPAC Name | 1,1-dideuterio-6-methoxy-3,4-dihydro-2H-isoquinoline |
| SMILES | [2H]C1([2H])NCCc2cc(OC)ccc21 |
| InChI | InChI=1S/C10H13NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-3,6,11H,4-5,7H2,1H3/i7D2 |
| InChIKey | YYTAYINRPUJPNH-RJSZUWSASA-N |
| XLogP | 1.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |