C12H19Cl2NO — CID 159371166
7-ethoxy-2,3,4,5-tetrahydro-1H-3-benzazepine;dihydrochloride (PubChem CID 159371166) has the molecular formula C12H19Cl2NO and a molecular weight of 264.20 g/mol. Its IUPAC name is 7-ethoxy-2,3,4,5-tetrahydro-1H-3-benzazepine;dihydrochloride.
| Compound Name | 7-ethoxy-2,3,4,5-tetrahydro-1H-3-benzazepine;dihydrochloride |
|---|---|
| PubChem CID | 159371166 |
| Molecular Formula | C12H19Cl2NO |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 7-ethoxy-2,3,4,5-tetrahydro-1H-3-benzazepine;dihydrochloride |
| SMILES | CCOc1ccc2c(c1)CCNCC2.Cl.Cl |
| InChI | InChI=1S/C12H17NO.2ClH/c1-2-14-12-4-3-10-5-7-13-8-6-11(10)9-12;;/h3-4,9,13H,2,5-8H2,1H3;2*1H |
| InChIKey | OAKAQDPGHCSVEL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |