C11H16ClNO — CID 70817218
(1S)-5-ethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (PubChem CID 70817218) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is (1S)-5-ethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride.
| Compound Name | (1S)-5-ethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
|---|---|
| PubChem CID | 70817218 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (1S)-5-ethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| SMILES | CCOc1ccc2c(c1)CC[C@@H]2N.Cl |
| InChI | InChI=1S/C11H15NO.ClH/c1-2-13-9-4-5-10-8(7-9)3-6-11(10)12;/h4-5,7,11H,2-3,6,12H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | QGJKLZLWNYOZSD-MERQFXBCSA-N |
| XLogP | 2.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |