C17H19NO — CID 107682898
5-[(3-methylphenyl)methoxy]-2,3-dihydro-1H-inden-1-amine (PubChem CID 107682898) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 5-[(3-methylphenyl)methoxy]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-[(3-methylphenyl)methoxy]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 107682898 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 5-[(3-methylphenyl)methoxy]-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cc1cccc(COc2ccc3c(c2)CCC3N)c1 |
| InChI | InChI=1S/C17H19NO/c1-12-3-2-4-13(9-12)11-19-15-6-7-16-14(10-15)5-8-17(16)18/h2-4,6-7,9-10,17H,5,8,11,18H2,1H3 |
| InChIKey | AJXFBFGALLMYGI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |