4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid

C17H17NO3 — CID 107683179

IUPAC4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid
SMILESNC1CCc2cc(OCc3ccc(C(=O)O)cc3)ccc21
InChIInChI=1S/C17H17NO3/c18-16-8-5-13-9-14(6-7-15(13)16)21-10-11-1-3-12(4-2-11)17(19)20/h1-4,6-7,9,16H,5,8,10,18H2,(H,19,20)
InChIKeyZPTYLGFZRDHVFD-UHFFFAOYSA-N
MW283.33 g/mol
LogP2.91
Rot. Bonds4

About 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid

4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid (PubChem CID 107683179) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid.

Molecular Properties

Compound Name4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid
PubChem CID107683179
Molecular FormulaC17H17NO3
Molecular Weight283.33 g/mol
Exact Mass283.12
IUPAC Name4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid
SMILESNC1CCc2cc(OCc3ccc(C(=O)O)cc3)ccc21
InChIInChI=1S/C17H17NO3/c18-16-8-5-13-9-14(6-7-15(13)16)21-10-11-1-3-12(4-2-11)17(19)20/h1-4,6-7,9,16H,5,8,10,18H2,(H,19,20)
InChIKeyZPTYLGFZRDHVFD-UHFFFAOYSA-N
XLogP2.91
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.33
LogP ≤ 52.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid?
The IUPAC name of 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid (CID 107683179) is 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid.
What is the SMILES notation for 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid?
The canonical SMILES for 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid is NC1CCc2cc(OCc3ccc(C(=O)O)cc3)ccc21.
What is the InChIKey of 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid?
The InChIKey is ZPTYLGFZRDHVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c18-16-8-5-13-9-14(6-7-15(13)16)21-10-11-1-3-12(4-2-11)17(19)20/h1-4,6-7,9,16H,5,8,10,18H2,(H,19,20).
What are the key properties of 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid?
4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid has a molecular weight of 283.33 g/mol, XLogP of 2.91, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-amino-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid is sourced from PubChem (CID 107683179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).