C20H29N — CID 162687970
ethane;5-methyl-2,3-dihydro-1H-inden-1-amine;1,3-xylene (PubChem CID 162687970) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is ethane;5-methyl-2,3-dihydro-1H-inden-1-amine;1,3-xylene.
| Compound Name | ethane;5-methyl-2,3-dihydro-1H-inden-1-amine;1,3-xylene |
|---|---|
| PubChem CID | 162687970 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | ethane;5-methyl-2,3-dihydro-1H-inden-1-amine;1,3-xylene |
| SMILES | CC.Cc1ccc2c(c1)CCC2N.Cc1cccc(C)c1 |
| InChI | InChI=1S/C10H13N.C8H10.C2H6/c1-7-2-4-9-8(6-7)3-5-10(9)11;1-7-4-3-5-8(2)6-7;1-2/h2,4,6,10H,3,5,11H2,1H3;3-6H,1-2H3;1-2H3 |
| InChIKey | ZUPIGQHBBZBCRM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |