C9H12ClNO — CID 156588205
(1S)-1-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride (PubChem CID 156588205) has the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. Its IUPAC name is (1S)-1-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride.
| Compound Name | (1S)-1-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride |
|---|---|
| PubChem CID | 156588205 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | (1S)-1-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride |
| SMILES | Cl.N[C@H]1CCc2cc(O)ccc21 |
| InChI | InChI=1S/C9H11NO.ClH/c10-9-4-1-6-5-7(11)2-3-8(6)9;/h2-3,5,9,11H,1,4,10H2;1H/t9-;/m0./s1 |
| InChIKey | LBXNDTMYJFQSDU-FVGYRXGTSA-N |
| XLogP | 1.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |