About 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol
1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682163) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 107682163 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | NCCCCNC1CCc2cc(O)ccc21 |
| InChI | InChI=1S/C13H20N2O/c14-7-1-2-8-15-13-6-3-10-9-11(16)4-5-12(10)13/h4-5,9,13,15-16H,1-3,6-8,14H2 |
| InChIKey | MZIPADZXPYSMQV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol (CID 107682163) is 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol is NCCCCNC1CCc2cc(O)ccc21.
What is the InChIKey of 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol?
The InChIKey is MZIPADZXPYSMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c14-7-1-2-8-15-13-6-3-10-9-11(16)4-5-12(10)13/h4-5,9,13,15-16H,1-3,6-8,14H2.
What are the key properties of 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol?
1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol has a molecular weight of 220.32 g/mol, XLogP of 1.71, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 107682163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).