C13H20N2O — CID 107682163
1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682163) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682163 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-(4-aminobutylamino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | NCCCCNC1CCc2cc(O)ccc21 |
| InChI | InChI=1S/C13H20N2O/c14-7-1-2-8-15-13-6-3-10-9-11(16)4-5-12(10)13/h4-5,9,13,15-16H,1-3,6-8,14H2 |
| InChIKey | MZIPADZXPYSMQV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|