C14H16N2OS — CID 107682370
1-[2-(1,3-thiazol-4-yl)ethylamino]-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682370) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-[2-(1,3-thiazol-4-yl)ethylamino]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-[2-(1,3-thiazol-4-yl)ethylamino]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682370 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-[2-(1,3-thiazol-4-yl)ethylamino]-2,3-dihydro-1H-inden-5-ol |
| SMILES | Oc1ccc2c(c1)CCC2NCCc1cscn1 |
| InChI | InChI=1S/C14H16N2OS/c17-12-2-3-13-10(7-12)1-4-14(13)15-6-5-11-8-18-9-16-11/h2-3,7-9,14-15,17H,1,4-6H2 |
| InChIKey | KPLUVWHQECOBLX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |