C12H16N2O3 — CID 107682607
2-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]ethyl carbamate (PubChem CID 107682607) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]ethyl carbamate.
| Compound Name | 2-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 107682607 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC1CCc2cc(O)ccc21 |
| InChI | InChI=1S/C12H16N2O3/c13-12(16)17-6-5-14-11-4-1-8-7-9(15)2-3-10(8)11/h2-3,7,11,14-15H,1,4-6H2,(H2,13,16) |
| InChIKey | WSFUTGKGTDBMFE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|