C16H25NO — CID 114200067
(1S)-5-(2,4-dimethylpentoxy)-2,3-dihydro-1H-inden-1-amine (PubChem CID 114200067) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (1S)-5-(2,4-dimethylpentoxy)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S)-5-(2,4-dimethylpentoxy)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 114200067 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (1S)-5-(2,4-dimethylpentoxy)-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC(C)CC(C)COc1ccc2c(c1)CC[C@@H]2N |
| InChI | InChI=1S/C16H25NO/c1-11(2)8-12(3)10-18-14-5-6-15-13(9-14)4-7-16(15)17/h5-6,9,11-12,16H,4,7-8,10,17H2,1-3H3/t12?,16-/m0/s1 |
| InChIKey | YCHXDBLURRRHFB-INSVYWFGSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |