C14H21NO3S — CID 107683001
5-(2-propylsulfonylethoxy)-2,3-dihydro-1H-inden-1-amine (PubChem CID 107683001) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 5-(2-propylsulfonylethoxy)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-(2-propylsulfonylethoxy)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 107683001 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-(2-propylsulfonylethoxy)-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCCS(=O)(=O)CCOc1ccc2c(c1)CCC2N |
| InChI | InChI=1S/C14H21NO3S/c1-2-8-19(16,17)9-7-18-12-4-5-13-11(10-12)3-6-14(13)15/h4-5,10,14H,2-3,6-9,15H2,1H3 |
| InChIKey | DQBWWNCLGYWYOB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |