C13H19NO — CID 62737273
3-ethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine (PubChem CID 62737273) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-ethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine.
| Compound Name | 3-ethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
|---|---|
| PubChem CID | 62737273 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-ethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
| SMILES | CCOc1ccc2c(c1)C(N)CCCC2 |
| InChI | InChI=1S/C13H19NO/c1-2-15-11-8-7-10-5-3-4-6-13(14)12(10)9-11/h7-9,13H,2-6,14H2,1H3 |
| InChIKey | SDOJEPVVMMPBFE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |