C11H16ClN — CID 131884185
(1R)-6-ethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (PubChem CID 131884185) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is (1R)-6-ethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride.
| Compound Name | (1R)-6-ethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
|---|---|
| PubChem CID | 131884185 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (1R)-6-ethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| SMILES | CCc1ccc2c(c1)[C@H](N)CC2.Cl |
| InChI | InChI=1S/C11H15N.ClH/c1-2-8-3-4-9-5-6-11(12)10(9)7-8;/h3-4,7,11H,2,5-6,12H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | NOCAVQNDXDQVMP-RFVHGSKJSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |