C12H25BrN4 — CID 174570808
6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine (PubChem CID 174570808) has the molecular formula C12H25BrN4 and a molecular weight of 305.26 g/mol. Its IUPAC name is 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine.
| Compound Name | 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine |
|---|---|
| PubChem CID | 174570808 |
| Molecular Formula | C12H25BrN4 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine |
| SMILES | CN.CN.CN.NC1CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C9H10BrN.3CH5N/c10-7-3-1-6-2-4-9(11)8(6)5-7;3*1-2/h1,3,5,9H,2,4,11H2;3*2H2,1H3 |
| InChIKey | ZLVZSGBCNRMPDV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |