About 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine
6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine (PubChem CID 174570808) has the molecular formula C12H25BrN4
and a molecular weight of 305.26 g/mol. Its IUPAC name is 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine.
Molecular Properties
| Compound Name | 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine |
| PubChem CID | 174570808 |
| Molecular Formula | C12H25BrN4 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine |
| SMILES | CN.CN.CN.NC1CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C9H10BrN.3CH5N/c10-7-3-1-6-2-4-9(11)8(6)5-7;3*1-2/h1,3,5,9H,2,4,11H2;3*2H2,1H3 |
| InChIKey | ZLVZSGBCNRMPDV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine?
The IUPAC name of 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine (CID 174570808) is 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine.
What is the SMILES notation for 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine?
The canonical SMILES for 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine is CN.CN.CN.NC1CCc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine?
The InChIKey is ZLVZSGBCNRMPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN.3CH5N/c10-7-3-1-6-2-4-9(11)8(6)5-7;3*1-2/h1,3,5,9H,2,4,11H2;3*2H2,1H3.
What are the key properties of 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine?
6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine has a molecular weight of 305.26 g/mol, XLogP of 1.12, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,3-dihydro-1H-inden-1-amine;methanamine is sourced from PubChem (CID 174570808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).