C10H9BrO — CID 134939038
6-bromo-2,3-dihydro-1H-indene-1-carbaldehyde (PubChem CID 134939038) has the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. Its IUPAC name is 6-bromo-2,3-dihydro-1H-indene-1-carbaldehyde.
| Compound Name | 6-bromo-2,3-dihydro-1H-indene-1-carbaldehyde |
|---|---|
| PubChem CID | 134939038 |
| Molecular Formula | C10H9BrO |
| Molecular Weight | 225.08 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | 6-bromo-2,3-dihydro-1H-indene-1-carbaldehyde |
| SMILES | O=CC1CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H9BrO/c11-9-4-3-7-1-2-8(6-12)10(7)5-9/h3-6,8H,1-2H2 |
| InChIKey | MKERWXHQEVLGBE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.08 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|