C10H10BrNO2 — CID 82380696
7-bromo-1-nitro-1,2,3,4-tetrahydronaphthalene (PubChem CID 82380696) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is 7-bromo-1-nitro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 7-bromo-1-nitro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 82380696 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 7-bromo-1-nitro-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=[N+]([O-])C1CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H10BrNO2/c11-8-5-4-7-2-1-3-10(12(13)14)9(7)6-8/h4-6,10H,1-3H2 |
| InChIKey | JIKRNCHXKZCKKI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|