C11H12BrNO — CID 175174429
N-[(7-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine (PubChem CID 175174429) has the molecular formula C11H12BrNO and a molecular weight of 254.13 g/mol. Its IUPAC name is N-[(7-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine.
| Compound Name | N-[(7-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 175174429 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | N-[(7-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine |
| SMILES | ON=CC1CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C11H12BrNO/c12-10-5-4-8-2-1-3-9(7-13-14)11(8)6-10/h4-7,9,14H,1-3H2 |
| InChIKey | FWUUEJYHSMKLMN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|