C18H19NO2 — CID 174750219
N-[(7-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine (PubChem CID 174750219) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(7-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine.
| Compound Name | N-[(7-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 174750219 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[(7-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine |
| SMILES | ON=CC1CCCc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C18H19NO2/c20-19-12-16-8-4-7-15-9-10-17(11-18(15)16)21-13-14-5-2-1-3-6-14/h1-3,5-6,9-12,16,20H,4,7-8,13H2 |
| InChIKey | CBGMKHQJKBFIIN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|