C21H24O — CID 142456783
6-phenylmethoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 142456783) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 6-phenylmethoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | 6-phenylmethoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 142456783 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 6-phenylmethoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | c1ccc(COc2ccc3c(c2)C2CCCCC2CC3)cc1 |
| InChI | InChI=1S/C21H24O/c1-2-6-16(7-3-1)15-22-19-13-12-18-11-10-17-8-4-5-9-20(17)21(18)14-19/h1-3,6-7,12-14,17,20H,4-5,8-11,15H2 |
| InChIKey | WQCBNRJUFQXAHW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |