C24H28O3 — CID 175012436
(1S,4S,4aS,10aR)-1,4-dimethyl-6-phenylmethoxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 175012436) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (1S,4S,4aS,10aR)-1,4-dimethyl-6-phenylmethoxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1S,4S,4aS,10aR)-1,4-dimethyl-6-phenylmethoxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 175012436 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (1S,4S,4aS,10aR)-1,4-dimethyl-6-phenylmethoxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | C[C@H]1CC[C@](C)(C(=O)O)[C@@H]2CCc3ccc(OCc4ccccc4)cc3[C@H]21 |
| InChI | InChI=1S/C24H28O3/c1-16-12-13-24(2,23(25)26)21-11-9-18-8-10-19(14-20(18)22(16)21)27-15-17-6-4-3-5-7-17/h3-8,10,14,16,21-22H,9,11-13,15H2,1-2H3,(H,25,26)/t16-,21+,22+,24-/m0/s1 |
| InChIKey | QKEKIDBEEOLIQD-IFONEHGPSA-N |
| XLogP | 5.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |