C25H30O3 — CID 175012186
methyl (1S,4S,4aS,10aR)-1,4-dimethyl-6-phenylmethoxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxylate (PubChem CID 175012186) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is methyl (1S,4S,4aS,10aR)-1,4-dimethyl-6-phenylmethoxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4S,4aS,10aR)-1,4-dimethyl-6-phenylmethoxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 175012186 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | methyl (1S,4S,4aS,10aR)-1,4-dimethyl-6-phenylmethoxy-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC[C@H](C)[C@@H]2c3cc(OCc4ccccc4)ccc3CC[C@H]21 |
| InChI | InChI=1S/C25H30O3/c1-17-13-14-25(2,24(26)27-3)22-12-10-19-9-11-20(15-21(19)23(17)22)28-16-18-7-5-4-6-8-18/h4-9,11,15,17,22-23H,10,12-14,16H2,1-3H3/t17-,22+,23+,25-/m0/s1 |
| InChIKey | KRFNMFZEEKCTLI-GHBLRSOESA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |